C16H16ClN3O6S — CID 7878680
[2-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoethyl] 2-[(4-chlorobenzoyl)amino]acetate (PubChem CID 7878680) has the molecular formula C16H16ClN3O6S and a molecular weight of 413.84 g/mol. Its IUPAC name is [2-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoethyl] 2-[(4-chlorobenzoyl)amino]acetate.
| Compound Name | [2-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoethyl] 2-[(4-chlorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 7878680 |
| Molecular Formula | C16H16ClN3O6S |
| Molecular Weight | 413.84 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | [2-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoethyl] 2-[(4-chlorobenzoyl)amino]acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccc(Cl)cc1)NCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C16H16ClN3O6S/c17-11-3-1-10(2-4-11)15(24)19-7-14(23)26-8-12(21)18-5-6-20-13(22)9-27-16(20)25/h1-4H,5-9H2,(H,18,21)(H,19,24) |
| InChIKey | IXTQYGDTIFFYBB-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.84 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|