C15H15FN2O6S — CID 7791424
[2-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoethyl] 2-(4-fluorophenoxy)acetate (PubChem CID 7791424) has the molecular formula C15H15FN2O6S and a molecular weight of 370.36 g/mol. Its IUPAC name is [2-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoethyl] 2-(4-fluorophenoxy)acetate.
| Compound Name | [2-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoethyl] 2-(4-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 7791424 |
| Molecular Formula | C15H15FN2O6S |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | [2-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoethyl] 2-(4-fluorophenoxy)acetate |
| SMILES | O=C(COC(=O)COc1ccc(F)cc1)NCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C15H15FN2O6S/c16-10-1-3-11(4-2-10)23-8-14(21)24-7-12(19)17-5-6-18-13(20)9-25-15(18)22/h1-4H,5-9H2,(H,17,19) |
| InChIKey | GOJRTIFWWPSYDL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|