C13H12Cl2N2O3S — CID 52717864
2-(3,4-dichlorophenyl)-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide (PubChem CID 52717864) has the molecular formula C13H12Cl2N2O3S and a molecular weight of 347.22 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 52717864 |
| Molecular Formula | C13H12Cl2N2O3S |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)NCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C13H12Cl2N2O3S/c14-9-2-1-8(5-10(9)15)6-11(18)16-3-4-17-12(19)7-21-13(17)20/h1-2,5H,3-4,6-7H2,(H,16,18) |
| InChIKey | LCWMGHGMQHRMRO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|