C8H9N3O3S — CID 22689011
2-cyano-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide (PubChem CID 22689011) has the molecular formula C8H9N3O3S and a molecular weight of 227.24 g/mol. Its IUPAC name is 2-cyano-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide.
| Compound Name | 2-cyano-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 22689011 |
| Molecular Formula | C8H9N3O3S |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 2-cyano-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide |
| SMILES | N#CCC(=O)NCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C8H9N3O3S/c9-2-1-6(12)10-3-4-11-7(13)5-15-8(11)14/h1,3-5H2,(H,10,12) |
| InChIKey | OQEAUOTWNGLFGN-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|