C7H9N3O5S — CID 108814531
N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-nitroacetamide (PubChem CID 108814531) has the molecular formula C7H9N3O5S and a molecular weight of 247.23 g/mol. Its IUPAC name is N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-nitroacetamide.
| Compound Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-nitroacetamide |
|---|---|
| PubChem CID | 108814531 |
| Molecular Formula | C7H9N3O5S |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-nitroacetamide |
| SMILES | O=C(C[N+](=O)[O-])NCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C7H9N3O5S/c11-5(3-10(14)15)8-1-2-9-6(12)4-16-7(9)13/h1-4H2,(H,8,11) |
| InChIKey | GZLRRPFGPQLLMG-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|