C10H15IN2O3S — CID 139517059
5-(2,4-dioxo-1,3-thiazolidin-3-yl)-N-(2-iodoethyl)pentanamide (PubChem CID 139517059) has the molecular formula C10H15IN2O3S and a molecular weight of 370.21 g/mol. Its IUPAC name is 5-(2,4-dioxo-1,3-thiazolidin-3-yl)-N-(2-iodoethyl)pentanamide.
| Compound Name | 5-(2,4-dioxo-1,3-thiazolidin-3-yl)-N-(2-iodoethyl)pentanamide |
|---|---|
| PubChem CID | 139517059 |
| Molecular Formula | C10H15IN2O3S |
| Molecular Weight | 370.21 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | 5-(2,4-dioxo-1,3-thiazolidin-3-yl)-N-(2-iodoethyl)pentanamide |
| SMILES | O=C(CCCCN1C(=O)CSC1=O)NCCI |
| InChI | InChI=1S/C10H15IN2O3S/c11-4-5-12-8(14)3-1-2-6-13-9(15)7-17-10(13)16/h1-7H2,(H,12,14) |
| InChIKey | LPNAJXOZRWIBFA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|