C8H11NO4S — CID 43378323
methyl 4-(2,4-dioxo-1,3-thiazolidin-3-yl)butanoate (PubChem CID 43378323) has the molecular formula C8H11NO4S and a molecular weight of 217.25 g/mol. Its IUPAC name is methyl 4-(2,4-dioxo-1,3-thiazolidin-3-yl)butanoate.
| Compound Name | methyl 4-(2,4-dioxo-1,3-thiazolidin-3-yl)butanoate |
|---|---|
| PubChem CID | 43378323 |
| Molecular Formula | C8H11NO4S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | methyl 4-(2,4-dioxo-1,3-thiazolidin-3-yl)butanoate |
| SMILES | COC(=O)CCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C8H11NO4S/c1-13-7(11)3-2-4-9-6(10)5-14-8(9)12/h2-5H2,1H3 |
| InChIKey | UNFBIKKFSQOXSW-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|