C5H6FNO2S — CID 126990912
3-(2-fluoroethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126990912) has the molecular formula C5H6FNO2S and a molecular weight of 163.17 g/mol. Its IUPAC name is 3-(2-fluoroethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-(2-fluoroethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126990912 |
| Molecular Formula | C5H6FNO2S |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.01 |
| IUPAC Name | 3-(2-fluoroethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1CSC(=O)N1CCF |
| InChI | InChI=1S/C5H6FNO2S/c6-1-2-7-4(8)3-10-5(7)9/h1-3H2 |
| InChIKey | WHLIGFMVUPLZLM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|