C5H4N2O2S — CID 87277907
2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetonitrile (PubChem CID 87277907) has the molecular formula C5H4N2O2S and a molecular weight of 156.17 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetonitrile.
| Compound Name | 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetonitrile |
|---|---|
| PubChem CID | 87277907 |
| Molecular Formula | C5H4N2O2S |
| Molecular Weight | 156.17 g/mol |
| Exact Mass | 156.00 |
| IUPAC Name | 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetonitrile |
| SMILES | N#CCN1C(=O)CSC1=O |
| InChI | InChI=1S/C5H4N2O2S/c6-1-2-7-4(8)3-10-5(7)9/h2-3H2 |
| InChIKey | YYSURWPKPGJXQA-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.17 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|