C5H7NO2S3 — CID 146369170
3-[2-(disulfanyl)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 146369170) has the molecular formula C5H7NO2S3 and a molecular weight of 209.32 g/mol. Its IUPAC name is 3-[2-(disulfanyl)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[2-(disulfanyl)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 146369170 |
| Molecular Formula | C5H7NO2S3 |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 208.96 |
| IUPAC Name | 3-[2-(disulfanyl)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1CSC(=O)N1CCSS |
| InChI | InChI=1S/C5H7NO2S3/c7-4-3-10-5(8)6(4)1-2-11-9/h9H,1-3H2 |
| InChIKey | KFBCPJGCGSWGJN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|