About 2-methylsulfanyl-1-(1,3-thiazolidin-3-yl)ethanone
2-methylsulfanyl-1-(1,3-thiazolidin-3-yl)ethanone (PubChem CID 127015662) has the molecular formula C6H11NOS2
and a molecular weight of 177.29 g/mol. Its IUPAC name is 2-methylsulfanyl-1-(1,3-thiazolidin-3-yl)ethanone.
Molecular Properties
| Compound Name | 2-methylsulfanyl-1-(1,3-thiazolidin-3-yl)ethanone |
| PubChem CID | 127015662 |
| Molecular Formula | C6H11NOS2 |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.03 |
| IUPAC Name | 2-methylsulfanyl-1-(1,3-thiazolidin-3-yl)ethanone |
| SMILES | CSCC(=O)N1CCSC1 |
| InChI | InChI=1S/C6H11NOS2/c1-9-4-6(8)7-2-3-10-5-7/h2-5H2,1H3 |
| InChIKey | XVDIBKULEHMFEG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylsulfanyl-1-(1,3-thiazolidin-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-1-(1,3-thiazolidin-3-yl)ethanone?
The IUPAC name of 2-methylsulfanyl-1-(1,3-thiazolidin-3-yl)ethanone (CID 127015662) is 2-methylsulfanyl-1-(1,3-thiazolidin-3-yl)ethanone.
What is the SMILES notation for 2-methylsulfanyl-1-(1,3-thiazolidin-3-yl)ethanone?
The canonical SMILES for 2-methylsulfanyl-1-(1,3-thiazolidin-3-yl)ethanone is CSCC(=O)N1CCSC1.
What is the InChIKey of 2-methylsulfanyl-1-(1,3-thiazolidin-3-yl)ethanone?
The InChIKey is XVDIBKULEHMFEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NOS2/c1-9-4-6(8)7-2-3-10-5-7/h2-5H2,1H3.
What are the key properties of 2-methylsulfanyl-1-(1,3-thiazolidin-3-yl)ethanone?
2-methylsulfanyl-1-(1,3-thiazolidin-3-yl)ethanone has a molecular weight of 177.29 g/mol, XLogP of 0.88, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-1-(1,3-thiazolidin-3-yl)ethanone is sourced from PubChem (CID 127015662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).