C6H5NO2S — CID 19712409
3-prop-2-ynyl-1,3-thiazolidine-2,4-dione (PubChem CID 19712409) has the molecular formula C6H5NO2S and a molecular weight of 155.18 g/mol. Its IUPAC name is 3-prop-2-ynyl-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-prop-2-ynyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 19712409 |
| Molecular Formula | C6H5NO2S |
| Molecular Weight | 155.18 g/mol |
| Exact Mass | 155.00 |
| IUPAC Name | 3-prop-2-ynyl-1,3-thiazolidine-2,4-dione |
| SMILES | C#CCN1C(=O)CSC1=O |
| InChI | InChI=1S/C6H5NO2S/c1-2-3-7-5(8)4-10-6(7)9/h1H,3-4H2 |
| InChIKey | AGUSZZRAQMEXDZ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.18 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|