C7H6N2O2S2 — CID 130634599
3-(1,3-thiazol-4-ylmethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 130634599) has the molecular formula C7H6N2O2S2 and a molecular weight of 214.27 g/mol. Its IUPAC name is 3-(1,3-thiazol-4-ylmethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-(1,3-thiazol-4-ylmethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 130634599 |
| Molecular Formula | C7H6N2O2S2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 213.99 |
| IUPAC Name | 3-(1,3-thiazol-4-ylmethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1CSC(=O)N1Cc1cscn1 |
| InChI | InChI=1S/C7H6N2O2S2/c10-6-3-13-7(11)9(6)1-5-2-12-4-8-5/h2,4H,1,3H2 |
| InChIKey | VZWVVXJEHLBELR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|