C12H10N2OS2 — CID 72892833
4-(1,3-thiazol-4-ylmethyl)-1,4-benzothiazin-3-one (PubChem CID 72892833) has the molecular formula C12H10N2OS2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 4-(1,3-thiazol-4-ylmethyl)-1,4-benzothiazin-3-one.
| Compound Name | 4-(1,3-thiazol-4-ylmethyl)-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 72892833 |
| Molecular Formula | C12H10N2OS2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 4-(1,3-thiazol-4-ylmethyl)-1,4-benzothiazin-3-one |
| SMILES | O=C1CSc2ccccc2N1Cc1cscn1 |
| InChI | InChI=1S/C12H10N2OS2/c15-12-7-17-11-4-2-1-3-10(11)14(12)5-9-6-16-8-13-9/h1-4,6,8H,5,7H2 |
| InChIKey | CKABKVGBMJLWNX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |