C17H14N4OS — CID 170639967
4-[(5-pyridin-2-yl-1H-imidazol-2-yl)methyl]-1,4-benzothiazin-3-one (PubChem CID 170639967) has the molecular formula C17H14N4OS and a molecular weight of 322.39 g/mol. Its IUPAC name is 4-[(5-pyridin-2-yl-1H-imidazol-2-yl)methyl]-1,4-benzothiazin-3-one.
| Compound Name | 4-[(5-pyridin-2-yl-1H-imidazol-2-yl)methyl]-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 170639967 |
| Molecular Formula | C17H14N4OS |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 4-[(5-pyridin-2-yl-1H-imidazol-2-yl)methyl]-1,4-benzothiazin-3-one |
| SMILES | O=C1CSc2ccccc2N1Cc1ncc(-c2ccccn2)[nH]1 |
| InChI | InChI=1S/C17H14N4OS/c22-17-11-23-15-7-2-1-6-14(15)21(17)10-16-19-9-13(20-16)12-5-3-4-8-18-12/h1-9H,10-11H2,(H,19,20) |
| InChIKey | GLKDIZGHLAVMIL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |