C10H13N3O2S — CID 64971193
6-ethyl-1-(1,3-thiazol-4-ylmethyl)piperazine-2,5-dione (PubChem CID 64971193) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is 6-ethyl-1-(1,3-thiazol-4-ylmethyl)piperazine-2,5-dione.
| Compound Name | 6-ethyl-1-(1,3-thiazol-4-ylmethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64971193 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 6-ethyl-1-(1,3-thiazol-4-ylmethyl)piperazine-2,5-dione |
| SMILES | CCC1C(=O)NCC(=O)N1Cc1cscn1 |
| InChI | InChI=1S/C10H13N3O2S/c1-2-8-10(15)11-3-9(14)13(8)4-7-5-16-6-12-7/h5-6,8H,2-4H2,1H3,(H,11,15) |
| InChIKey | VEDKLDDYETUHDY-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |