C11H16N4O2 — CID 64879083
6-ethyl-1-[(1-methylpyrazol-4-yl)methyl]piperazine-2,5-dione (PubChem CID 64879083) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 6-ethyl-1-[(1-methylpyrazol-4-yl)methyl]piperazine-2,5-dione.
| Compound Name | 6-ethyl-1-[(1-methylpyrazol-4-yl)methyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 64879083 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 6-ethyl-1-[(1-methylpyrazol-4-yl)methyl]piperazine-2,5-dione |
| SMILES | CCC1C(=O)NCC(=O)N1Cc1cnn(C)c1 |
| InChI | InChI=1S/C11H16N4O2/c1-3-9-11(17)12-5-10(16)15(9)7-8-4-13-14(2)6-8/h4,6,9H,3,5,7H2,1-2H3,(H,12,17) |
| InChIKey | AKGAJCWGZPIXDX-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |