C10H8FNO2S — CID 3157072
3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 3157072) has the molecular formula C10H8FNO2S and a molecular weight of 225.24 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 3157072 |
| Molecular Formula | C10H8FNO2S |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | 3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1CSC(=O)N1Cc1ccccc1F |
| InChI | InChI=1S/C10H8FNO2S/c11-8-4-2-1-3-7(8)5-12-9(13)6-15-10(12)14/h1-4H,5-6H2 |
| InChIKey | VJTWMNUDIIAJMS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|