C11H11N3O3S — CID 43376184
3-amino-4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide (PubChem CID 43376184) has the molecular formula C11H11N3O3S and a molecular weight of 265.29 g/mol. Its IUPAC name is 3-amino-4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide.
| Compound Name | 3-amino-4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 43376184 |
| Molecular Formula | C11H11N3O3S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 3-amino-4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide |
| SMILES | NC(=O)c1ccc(CN2C(=O)CSC2=O)c(N)c1 |
| InChI | InChI=1S/C11H11N3O3S/c12-8-3-6(10(13)16)1-2-7(8)4-14-9(15)5-18-11(14)17/h1-3H,4-5,12H2,(H2,13,16) |
| InChIKey | VBPLIPOALBFLST-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|