C9H9N3O3S2 — CID 63639887
3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]thiophene-2-carbohydrazide (PubChem CID 63639887) has the molecular formula C9H9N3O3S2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]thiophene-2-carbohydrazide.
| Compound Name | 3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 63639887 |
| Molecular Formula | C9H9N3O3S2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | 3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]thiophene-2-carbohydrazide |
| SMILES | NNC(=O)c1sccc1CN1C(=O)CSC1=O |
| InChI | InChI=1S/C9H9N3O3S2/c10-11-8(14)7-5(1-2-16-7)3-12-6(13)4-17-9(12)15/h1-2H,3-4,10H2,(H,11,14) |
| InChIKey | QJCYETPTBHAJNZ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|