C9H10N4OS — CID 63640929
3-(imidazol-1-ylmethyl)thiophene-2-carbohydrazide (PubChem CID 63640929) has the molecular formula C9H10N4OS and a molecular weight of 222.27 g/mol. Its IUPAC name is 3-(imidazol-1-ylmethyl)thiophene-2-carbohydrazide.
| Compound Name | 3-(imidazol-1-ylmethyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 63640929 |
| Molecular Formula | C9H10N4OS |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 3-(imidazol-1-ylmethyl)thiophene-2-carbohydrazide |
| SMILES | NNC(=O)c1sccc1Cn1ccnc1 |
| InChI | InChI=1S/C9H10N4OS/c10-12-9(14)8-7(1-4-15-8)5-13-3-2-11-6-13/h1-4,6H,5,10H2,(H,12,14) |
| InChIKey | FLNBWMPJFPNSSK-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|