C8H7N3O2S — CID 131142423
2-(imidazol-1-ylmethyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 131142423) has the molecular formula C8H7N3O2S and a molecular weight of 209.23 g/mol. Its IUPAC name is 2-(imidazol-1-ylmethyl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(imidazol-1-ylmethyl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 131142423 |
| Molecular Formula | C8H7N3O2S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 2-(imidazol-1-ylmethyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(Cn2ccnc2)s1 |
| InChI | InChI=1S/C8H7N3O2S/c12-8(13)6-3-10-7(14-6)4-11-2-1-9-5-11/h1-3,5H,4H2,(H,12,13) |
| InChIKey | LNANXDNALXWWCM-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |