C7H6ClN3S — CID 1488034
2-chloro-5-(imidazol-1-ylmethyl)-1,3-thiazole (PubChem CID 1488034) has the molecular formula C7H6ClN3S and a molecular weight of 199.67 g/mol. Its IUPAC name is 2-chloro-5-(imidazol-1-ylmethyl)-1,3-thiazole.
| Compound Name | 2-chloro-5-(imidazol-1-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 1488034 |
| Molecular Formula | C7H6ClN3S |
| Molecular Weight | 199.67 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | 2-chloro-5-(imidazol-1-ylmethyl)-1,3-thiazole |
| SMILES | Clc1ncc(Cn2ccnc2)s1 |
| InChI | InChI=1S/C7H6ClN3S/c8-7-10-3-6(12-7)4-11-2-1-9-5-11/h1-3,5H,4H2 |
| InChIKey | DUVLPCLPBKNVBL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.67 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |