C9H11N3S — CID 130847397
5-ethyl-2-(imidazol-1-ylmethyl)-1,3-thiazole (PubChem CID 130847397) has the molecular formula C9H11N3S and a molecular weight of 193.28 g/mol. Its IUPAC name is 5-ethyl-2-(imidazol-1-ylmethyl)-1,3-thiazole.
| Compound Name | 5-ethyl-2-(imidazol-1-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 130847397 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.28 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 5-ethyl-2-(imidazol-1-ylmethyl)-1,3-thiazole |
| SMILES | CCc1cnc(Cn2ccnc2)s1 |
| InChI | InChI=1S/C9H11N3S/c1-2-8-5-11-9(13-8)6-12-4-3-10-7-12/h3-5,7H,2,6H2,1H3 |
| InChIKey | FPEWKBIHQBFFIW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |