C21H24N6O3 — CID 102363409
1-[[3,5-bis(imidazol-1-ylmethyl)-2,4,6-trimethoxyphenyl]methyl]imidazole (PubChem CID 102363409) has the molecular formula C21H24N6O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is 1-[[3,5-bis(imidazol-1-ylmethyl)-2,4,6-trimethoxyphenyl]methyl]imidazole.
| Compound Name | 1-[[3,5-bis(imidazol-1-ylmethyl)-2,4,6-trimethoxyphenyl]methyl]imidazole |
|---|---|
| PubChem CID | 102363409 |
| Molecular Formula | C21H24N6O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 1-[[3,5-bis(imidazol-1-ylmethyl)-2,4,6-trimethoxyphenyl]methyl]imidazole |
| SMILES | COc1c(Cn2ccnc2)c(OC)c(Cn2ccnc2)c(OC)c1Cn1ccnc1 |
| InChI | InChI=1S/C21H24N6O3/c1-28-19-16(10-25-7-4-22-13-25)20(29-2)18(12-27-9-6-24-15-27)21(30-3)17(19)11-26-8-5-23-14-26/h4-9,13-15H,10-12H2,1-3H3 |
| InChIKey | JZTKBTASJIPYJH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 81.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |