C7H12N2O2 — CID 12922722
1-(2,2-dimethoxyethyl)imidazole (PubChem CID 12922722) has the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)imidazole.
| Compound Name | 1-(2,2-dimethoxyethyl)imidazole |
|---|---|
| PubChem CID | 12922722 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)imidazole |
| SMILES | COC(Cn1ccnc1)OC |
| InChI | InChI=1S/C7H12N2O2/c1-10-7(11-2)5-9-4-3-8-6-9/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | YREPEXAYKZWBSE-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|