C10H18N2 — CID 91321632
1-(2,3-dimethylpentyl)imidazole (PubChem CID 91321632) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 1-(2,3-dimethylpentyl)imidazole.
| Compound Name | 1-(2,3-dimethylpentyl)imidazole |
|---|---|
| PubChem CID | 91321632 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1-(2,3-dimethylpentyl)imidazole |
| SMILES | CCC(C)C(C)Cn1ccnc1 |
| InChI | InChI=1S/C10H18N2/c1-4-9(2)10(3)7-12-6-5-11-8-12/h5-6,8-10H,4,7H2,1-3H3 |
| InChIKey | SVCXLDXJOWLNAA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |