C15H21N3O3 — CID 61494818
N-(3-imidazol-1-ylpropyl)-3,4,5-trimethoxyaniline (PubChem CID 61494818) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-3,4,5-trimethoxyaniline.
| Compound Name | N-(3-imidazol-1-ylpropyl)-3,4,5-trimethoxyaniline |
|---|---|
| PubChem CID | 61494818 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-3,4,5-trimethoxyaniline |
| SMILES | COc1cc(NCCCn2ccnc2)cc(OC)c1OC |
| InChI | InChI=1S/C15H21N3O3/c1-19-13-9-12(10-14(20-2)15(13)21-3)17-5-4-7-18-8-6-16-11-18/h6,8-11,17H,4-5,7H2,1-3H3 |
| InChIKey | SCGJYHSILAZNDS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|