C12H19NO3S — CID 115224657
3-(3,4,5-trimethoxyanilino)propane-1-thiol (PubChem CID 115224657) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is 3-(3,4,5-trimethoxyanilino)propane-1-thiol.
| Compound Name | 3-(3,4,5-trimethoxyanilino)propane-1-thiol |
|---|---|
| PubChem CID | 115224657 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 3-(3,4,5-trimethoxyanilino)propane-1-thiol |
| SMILES | COc1cc(NCCCS)cc(OC)c1OC |
| InChI | InChI=1S/C12H19NO3S/c1-14-10-7-9(13-5-4-6-17)8-11(15-2)12(10)16-3/h7-8,13,17H,4-6H2,1-3H3 |
| InChIKey | SDEHHNRVLGZCOU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|