C11H17NO4 — CID 28571961
2-(3,4,5-trimethoxyanilino)ethanol (PubChem CID 28571961) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-(3,4,5-trimethoxyanilino)ethanol.
| Compound Name | 2-(3,4,5-trimethoxyanilino)ethanol |
|---|---|
| PubChem CID | 28571961 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-(3,4,5-trimethoxyanilino)ethanol |
| SMILES | COc1cc(NCCO)cc(OC)c1OC |
| InChI | InChI=1S/C11H17NO4/c1-14-9-6-8(12-4-5-13)7-10(15-2)11(9)16-3/h6-7,12-13H,4-5H2,1-3H3 |
| InChIKey | NBJQSHMDRPAEBQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|