C13H20N2O4S — CID 17272370
1-(3-hydroxypropyl)-3-(3,4,5-trimethoxyphenyl)thiourea (PubChem CID 17272370) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-3-(3,4,5-trimethoxyphenyl)thiourea.
| Compound Name | 1-(3-hydroxypropyl)-3-(3,4,5-trimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 17272370 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 1-(3-hydroxypropyl)-3-(3,4,5-trimethoxyphenyl)thiourea |
| SMILES | COc1cc(NC(=S)NCCCO)cc(OC)c1OC |
| InChI | InChI=1S/C13H20N2O4S/c1-17-10-7-9(8-11(18-2)12(10)19-3)15-13(20)14-5-4-6-16/h7-8,16H,4-6H2,1-3H3,(H2,14,15,20) |
| InChIKey | ZMJATBPMFHUHCO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 71.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|