C14H24N3O3S+ — CID 8620475
dimethyl-[2-[(3,4,5-trimethoxyphenyl)carbamothioylamino]ethyl]azanium (PubChem CID 8620475) has the molecular formula C14H24N3O3S+ and a molecular weight of 314.43 g/mol. Its IUPAC name is dimethyl-[2-[(3,4,5-trimethoxyphenyl)carbamothioylamino]ethyl]azanium.
| Compound Name | dimethyl-[2-[(3,4,5-trimethoxyphenyl)carbamothioylamino]ethyl]azanium |
|---|---|
| PubChem CID | 8620475 |
| Molecular Formula | C14H24N3O3S+ |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | dimethyl-[2-[(3,4,5-trimethoxyphenyl)carbamothioylamino]ethyl]azanium |
| SMILES | COc1cc(NC(=S)NCC[NH+](C)C)cc(OC)c1OC |
| InChI | InChI=1S/C14H23N3O3S/c1-17(2)7-6-15-14(21)16-10-8-11(18-3)13(20-5)12(9-10)19-4/h8-9H,6-7H2,1-5H3,(H2,15,16,21)/p+1 |
| InChIKey | VNZGGZLIDUJKRZ-UHFFFAOYSA-O |
| XLogP | 0.14 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|