C16H29N4O3S2+ — CID 8617163
2-[[5-(diethylsulfamoyl)-2-methoxyphenyl]carbamothioylamino]ethyl-dimethylazanium (PubChem CID 8617163) has the molecular formula C16H29N4O3S2+ and a molecular weight of 389.57 g/mol. Its IUPAC name is 2-[[5-(diethylsulfamoyl)-2-methoxyphenyl]carbamothioylamino]ethyl-dimethylazanium.
| Compound Name | 2-[[5-(diethylsulfamoyl)-2-methoxyphenyl]carbamothioylamino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 8617163 |
| Molecular Formula | C16H29N4O3S2+ |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 2-[[5-(diethylsulfamoyl)-2-methoxyphenyl]carbamothioylamino]ethyl-dimethylazanium |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC)c(NC(=S)NCC[NH+](C)C)c1 |
| InChI | InChI=1S/C16H28N4O3S2/c1-6-20(7-2)25(21,22)13-8-9-15(23-5)14(12-13)18-16(24)17-10-11-19(3)4/h8-9,12H,6-7,10-11H2,1-5H3,(H2,17,18,24)/p+1 |
| InChIKey | OJHICRZMYIMZLO-UHFFFAOYSA-O |
| XLogP | 0.16 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|