C17H31N4O2S2+ — CID 8697202
2-[[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]carbamothioylamino]ethyl-dimethylazanium (PubChem CID 8697202) has the molecular formula C17H31N4O2S2+ and a molecular weight of 387.60 g/mol. Its IUPAC name is 2-[[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]carbamothioylamino]ethyl-dimethylazanium.
| Compound Name | 2-[[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]carbamothioylamino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 8697202 |
| Molecular Formula | C17H31N4O2S2+ |
| Molecular Weight | 387.60 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 2-[[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]carbamothioylamino]ethyl-dimethylazanium |
| SMILES | CCN(CC)S(=O)(=O)c1ccc([C@H](C)NC(=S)NCC[NH+](C)C)cc1 |
| InChI | InChI=1S/C17H30N4O2S2/c1-6-21(7-2)25(22,23)16-10-8-15(9-11-16)14(3)19-17(24)18-12-13-20(4)5/h8-11,14H,6-7,12-13H2,1-5H3,(H2,18,19,24)/p+1/t14-/m0/s1 |
| InChIKey | OXYSTWLIYZHKAO-AWEZNQCLSA-O |
| XLogP | 0.39 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.60 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|