C15H26ClN3O3S — CID 119269825
(2R)-2-amino-N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]propanamide;hydrochloride (PubChem CID 119269825) has the molecular formula C15H26ClN3O3S and a molecular weight of 363.91 g/mol. Its IUPAC name is (2R)-2-amino-N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]propanamide;hydrochloride.
| Compound Name | (2R)-2-amino-N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119269825 |
| Molecular Formula | C15H26ClN3O3S |
| Molecular Weight | 363.91 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | (2R)-2-amino-N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]propanamide;hydrochloride |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(C)NC(=O)[C@@H](C)N)cc1.Cl |
| InChI | InChI=1S/C15H25N3O3S.ClH/c1-5-18(6-2)22(20,21)14-9-7-13(8-10-14)12(4)17-15(19)11(3)16;/h7-12H,5-6,16H2,1-4H3,(H,17,19);1H/t11-,12?;/m1./s1 |
| InChIKey | BHIMDDDLQDVVRM-BAVFUAOSSA-N |
| XLogP | 1.66 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.91 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |