C18H24N2O3S2 — CID 31526246
N-[(1R)-1-[4-(diethylsulfamoyl)phenyl]ethyl]-5-methylthiophene-2-carboxamide (PubChem CID 31526246) has the molecular formula C18H24N2O3S2 and a molecular weight of 380.54 g/mol. Its IUPAC name is N-[(1R)-1-[4-(diethylsulfamoyl)phenyl]ethyl]-5-methylthiophene-2-carboxamide.
| Compound Name | N-[(1R)-1-[4-(diethylsulfamoyl)phenyl]ethyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 31526246 |
| Molecular Formula | C18H24N2O3S2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-[(1R)-1-[4-(diethylsulfamoyl)phenyl]ethyl]-5-methylthiophene-2-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc([C@@H](C)NC(=O)c2ccc(C)s2)cc1 |
| InChI | InChI=1S/C18H24N2O3S2/c1-5-20(6-2)25(22,23)16-10-8-15(9-11-16)14(4)19-18(21)17-12-7-13(3)24-17/h7-12,14H,5-6H2,1-4H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | IGWBGOXMZBVLLJ-CQSZACIVSA-N |
| XLogP | 3.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |