C20H23F3N2O3S — CID 32752664
N-[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]-2-(trifluoromethyl)benzamide (PubChem CID 32752664) has the molecular formula C20H23F3N2O3S and a molecular weight of 428.48 g/mol. Its IUPAC name is N-[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 32752664 |
| Molecular Formula | C20H23F3N2O3S |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | N-[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]-2-(trifluoromethyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc([C@H](C)NC(=O)c2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H23F3N2O3S/c1-4-25(5-2)29(27,28)16-12-10-15(11-13-16)14(3)24-19(26)17-8-6-7-9-18(17)20(21,22)23/h6-14H,4-5H2,1-3H3,(H,24,26)/t14-/m0/s1 |
| InChIKey | AOZYIKJAYLGHQC-AWEZNQCLSA-N |
| XLogP | 4.23 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |