C22H28F3N3O3S — CID 55432689
2-[1-[4-(diethylsulfamoyl)phenyl]ethylamino]-N-[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 55432689) has the molecular formula C22H28F3N3O3S and a molecular weight of 471.55 g/mol. Its IUPAC name is 2-[1-[4-(diethylsulfamoyl)phenyl]ethylamino]-N-[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-[1-[4-(diethylsulfamoyl)phenyl]ethylamino]-N-[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 55432689 |
| Molecular Formula | C22H28F3N3O3S |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 2-[1-[4-(diethylsulfamoyl)phenyl]ethylamino]-N-[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(C)NC(C)C(=O)Nc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H28F3N3O3S/c1-5-28(6-2)32(30,31)18-13-11-17(12-14-18)15(3)26-16(4)21(29)27-20-10-8-7-9-19(20)22(23,24)25/h7-16,26H,5-6H2,1-4H3,(H,27,29) |
| InChIKey | WSWVBHMLUXZARD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |