C17H27N3O5S — CID 8650979
methyl N-[(2R)-2-[[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]amino]propanoyl]carbamate (PubChem CID 8650979) has the molecular formula C17H27N3O5S and a molecular weight of 385.49 g/mol. Its IUPAC name is methyl N-[(2R)-2-[[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]amino]propanoyl]carbamate.
| Compound Name | methyl N-[(2R)-2-[[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]amino]propanoyl]carbamate |
|---|---|
| PubChem CID | 8650979 |
| Molecular Formula | C17H27N3O5S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | methyl N-[(2R)-2-[[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]amino]propanoyl]carbamate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc([C@H](C)N[C@H](C)C(=O)NC(=O)OC)cc1 |
| InChI | InChI=1S/C17H27N3O5S/c1-6-20(7-2)26(23,24)15-10-8-14(9-11-15)12(3)18-13(4)16(21)19-17(22)25-5/h8-13,18H,6-7H2,1-5H3,(H,19,21,22)/t12-,13+/m0/s1 |
| InChIKey | NLRJZLKYROCABP-QWHCGFSZSA-N |
| XLogP | 1.64 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |