C18H18ClF3N2O — CID 51243791
2-[1-(3-chlorophenyl)ethylamino]-N-[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 51243791) has the molecular formula C18H18ClF3N2O and a molecular weight of 370.80 g/mol. Its IUPAC name is 2-[1-(3-chlorophenyl)ethylamino]-N-[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-[1-(3-chlorophenyl)ethylamino]-N-[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 51243791 |
| Molecular Formula | C18H18ClF3N2O |
| Molecular Weight | 370.80 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-[1-(3-chlorophenyl)ethylamino]-N-[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(NC(C)c1cccc(Cl)c1)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H18ClF3N2O/c1-11(13-6-5-7-14(19)10-13)23-12(2)17(25)24-16-9-4-3-8-15(16)18(20,21)22/h3-12,23H,1-2H3,(H,24,25) |
| InChIKey | DHTODUXTXNVZQS-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.80 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |