C19H23ClN2O3 — CID 51243795
2-[1-(3-chlorophenyl)ethylamino]-N-(3,4-dimethoxyphenyl)propanamide (PubChem CID 51243795) has the molecular formula C19H23ClN2O3 and a molecular weight of 362.86 g/mol. Its IUPAC name is 2-[1-(3-chlorophenyl)ethylamino]-N-(3,4-dimethoxyphenyl)propanamide.
| Compound Name | 2-[1-(3-chlorophenyl)ethylamino]-N-(3,4-dimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 51243795 |
| Molecular Formula | C19H23ClN2O3 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-[1-(3-chlorophenyl)ethylamino]-N-(3,4-dimethoxyphenyl)propanamide |
| SMILES | COc1ccc(NC(=O)C(C)NC(C)c2cccc(Cl)c2)cc1OC |
| InChI | InChI=1S/C19H23ClN2O3/c1-12(14-6-5-7-15(20)10-14)21-13(2)19(23)22-16-8-9-17(24-3)18(11-16)25-4/h5-13,21H,1-4H3,(H,22,23) |
| InChIKey | DEQBUWPGWGXNGV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |