C16H27N3O4S — CID 17257281
3-[5-(diethylsulfamoyl)-2-methoxyphenyl]-1,1-diethylurea (PubChem CID 17257281) has the molecular formula C16H27N3O4S and a molecular weight of 357.48 g/mol. Its IUPAC name is 3-[5-(diethylsulfamoyl)-2-methoxyphenyl]-1,1-diethylurea.
| Compound Name | 3-[5-(diethylsulfamoyl)-2-methoxyphenyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 17257281 |
| Molecular Formula | C16H27N3O4S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 3-[5-(diethylsulfamoyl)-2-methoxyphenyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1cc(S(=O)(=O)N(CC)CC)ccc1OC |
| InChI | InChI=1S/C16H27N3O4S/c1-6-18(7-2)16(20)17-14-12-13(10-11-15(14)23-5)24(21,22)19(8-3)9-4/h10-12H,6-9H2,1-5H3,(H,17,20) |
| InChIKey | UOUSDFFHJBAUGZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |