C15H26N3S+ — CID 8620616
2-[(4-tert-butylphenyl)carbamothioylamino]ethyl-dimethylazanium (PubChem CID 8620616) has the molecular formula C15H26N3S+ and a molecular weight of 280.46 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)carbamothioylamino]ethyl-dimethylazanium.
| Compound Name | 2-[(4-tert-butylphenyl)carbamothioylamino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 8620616 |
| Molecular Formula | C15H26N3S+ |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-[(4-tert-butylphenyl)carbamothioylamino]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCNC(=S)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H25N3S/c1-15(2,3)12-6-8-13(9-7-12)17-14(19)16-10-11-18(4)5/h6-9H,10-11H2,1-5H3,(H2,16,17,19)/p+1 |
| InChIKey | UTXKMORLRKBDEO-UHFFFAOYSA-O |
| XLogP | 1.41 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|