C15H26N5S2+ — CID 8619130
dimethyl-[2-[[(4-propan-2-ylphenyl)carbamothioylamino]carbamothioylamino]ethyl]azanium (PubChem CID 8619130) has the molecular formula C15H26N5S2+ and a molecular weight of 340.54 g/mol. Its IUPAC name is dimethyl-[2-[[(4-propan-2-ylphenyl)carbamothioylamino]carbamothioylamino]ethyl]azanium.
| Compound Name | dimethyl-[2-[[(4-propan-2-ylphenyl)carbamothioylamino]carbamothioylamino]ethyl]azanium |
|---|---|
| PubChem CID | 8619130 |
| Molecular Formula | C15H26N5S2+ |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | dimethyl-[2-[[(4-propan-2-ylphenyl)carbamothioylamino]carbamothioylamino]ethyl]azanium |
| SMILES | CC(C)c1ccc(NC(=S)NNC(=S)NCC[NH+](C)C)cc1 |
| InChI | InChI=1S/C15H25N5S2/c1-11(2)12-5-7-13(8-6-12)17-15(22)19-18-14(21)16-9-10-20(3)4/h5-8,11H,9-10H2,1-4H3,(H2,16,18,21)(H2,17,19,22)/p+1 |
| InChIKey | LNKGGIAFLIVLPU-UHFFFAOYSA-O |
| XLogP | 0.62 |
| TPSA | 52.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|