C12H19BrN5S2+ — CID 9238524
2-[[(3-bromophenyl)carbamothioylamino]carbamothioylamino]ethyl-dimethylazanium (PubChem CID 9238524) has the molecular formula C12H19BrN5S2+ and a molecular weight of 377.36 g/mol. Its IUPAC name is 2-[[(3-bromophenyl)carbamothioylamino]carbamothioylamino]ethyl-dimethylazanium.
| Compound Name | 2-[[(3-bromophenyl)carbamothioylamino]carbamothioylamino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 9238524 |
| Molecular Formula | C12H19BrN5S2+ |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 2-[[(3-bromophenyl)carbamothioylamino]carbamothioylamino]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCNC(=S)NNC(=S)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C12H18BrN5S2/c1-18(2)7-6-14-11(19)16-17-12(20)15-10-5-3-4-9(13)8-10/h3-5,8H,6-7H2,1-2H3,(H2,14,16,19)(H2,15,17,20)/p+1 |
| InChIKey | OQVGSGHLMPDXAQ-UHFFFAOYSA-O |
| XLogP | 0.26 |
| TPSA | 52.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|