C14H24N5S2+ — CID 8616850
2-[[(2,6-dimethylphenyl)carbamothioylamino]carbamothioylamino]ethyl-dimethylazanium (PubChem CID 8616850) has the molecular formula C14H24N5S2+ and a molecular weight of 326.52 g/mol. Its IUPAC name is 2-[[(2,6-dimethylphenyl)carbamothioylamino]carbamothioylamino]ethyl-dimethylazanium.
| Compound Name | 2-[[(2,6-dimethylphenyl)carbamothioylamino]carbamothioylamino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 8616850 |
| Molecular Formula | C14H24N5S2+ |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 2-[[(2,6-dimethylphenyl)carbamothioylamino]carbamothioylamino]ethyl-dimethylazanium |
| SMILES | Cc1cccc(C)c1NC(=S)NNC(=S)NCC[NH+](C)C |
| InChI | InChI=1S/C14H23N5S2/c1-10-6-5-7-11(2)12(10)16-14(21)18-17-13(20)15-8-9-19(3)4/h5-7H,8-9H2,1-4H3,(H2,15,17,20)(H2,16,18,21)/p+1 |
| InChIKey | IHMVJFDNDAERKZ-UHFFFAOYSA-O |
| XLogP | 0.11 |
| TPSA | 52.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|