C11H16N2OS — CID 2731006
1-(2,6-dimethylphenyl)-3-(2-hydroxyethyl)thiourea (PubChem CID 2731006) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-(2-hydroxyethyl)thiourea.
| Compound Name | 1-(2,6-dimethylphenyl)-3-(2-hydroxyethyl)thiourea |
|---|---|
| PubChem CID | 2731006 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-(2-hydroxyethyl)thiourea |
| SMILES | Cc1cccc(C)c1NC(=S)NCCO |
| InChI | InChI=1S/C11H16N2OS/c1-8-4-3-5-9(2)10(8)13-11(15)12-6-7-14/h3-5,14H,6-7H2,1-2H3,(H2,12,13,15) |
| InChIKey | JYWDCHNCNXURHP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|