C10H16N2O — CID 13200571
2-[2-(2,6-dimethylphenyl)hydrazinyl]ethanol (PubChem CID 13200571) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-[2-(2,6-dimethylphenyl)hydrazinyl]ethanol.
| Compound Name | 2-[2-(2,6-dimethylphenyl)hydrazinyl]ethanol |
|---|---|
| PubChem CID | 13200571 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-[2-(2,6-dimethylphenyl)hydrazinyl]ethanol |
| SMILES | Cc1cccc(C)c1NNCCO |
| InChI | InChI=1S/C10H16N2O/c1-8-4-3-5-9(2)10(8)12-11-6-7-13/h3-5,11-13H,6-7H2,1-2H3 |
| InChIKey | ZLYFBMIOEUZEDZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|