C12H21NO2 — CID 174810256
2-(2-hydroxyethylamino)ethanol;1,2-xylene (PubChem CID 174810256) has the molecular formula C12H21NO2 and a molecular weight of 211.31 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)ethanol;1,2-xylene.
| Compound Name | 2-(2-hydroxyethylamino)ethanol;1,2-xylene |
|---|---|
| PubChem CID | 174810256 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 2-(2-hydroxyethylamino)ethanol;1,2-xylene |
| SMILES | Cc1ccccc1C.OCCNCCO |
| InChI | InChI=1S/C8H10.C4H11NO2/c1-7-5-3-4-6-8(7)2;6-3-1-5-2-4-7/h3-6H,1-2H3;5-7H,1-4H2 |
| InChIKey | GEBMUDPCKCHIGT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|