About 2-(2-hydroxyethylamino)ethanol;[(1S)-1-phenylethyl]boronic acid
2-(2-hydroxyethylamino)ethanol;[(1S)-1-phenylethyl]boronic acid (PubChem CID 121012623) has the molecular formula C12H22BNO4
and a molecular weight of 255.12 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)ethanol;[(1S)-1-phenylethyl]boronic acid.
Molecular Properties
| Compound Name | 2-(2-hydroxyethylamino)ethanol;[(1S)-1-phenylethyl]boronic acid |
| PubChem CID | 121012623 |
| Molecular Formula | C12H22BNO4 |
| Molecular Weight | 255.12 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 2-(2-hydroxyethylamino)ethanol;[(1S)-1-phenylethyl]boronic acid |
| SMILES | C[C@H](B(O)O)c1ccccc1.OCCNCCO |
| InChI | InChI=1S/C8H11BO2.C4H11NO2/c1-7(9(10)11)8-5-3-2-4-6-8;6-3-1-5-2-4-7/h2-7,10-11H,1H3;5-7H,1-4H2/t7-;/m0./s1 |
| InChIKey | FUGYADAVGFHPGI-FJXQXJEOSA-N |
| XLogP | -0.64 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.12 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyethylamino)ethanol;[(1S)-1-phenylethyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethylamino)ethanol;[(1S)-1-phenylethyl]boronic acid?
The IUPAC name of 2-(2-hydroxyethylamino)ethanol;[(1S)-1-phenylethyl]boronic acid (CID 121012623) is 2-(2-hydroxyethylamino)ethanol;[(1S)-1-phenylethyl]boronic acid.
What is the SMILES notation for 2-(2-hydroxyethylamino)ethanol;[(1S)-1-phenylethyl]boronic acid?
The canonical SMILES for 2-(2-hydroxyethylamino)ethanol;[(1S)-1-phenylethyl]boronic acid is C[C@H](B(O)O)c1ccccc1.OCCNCCO.
What is the InChIKey of 2-(2-hydroxyethylamino)ethanol;[(1S)-1-phenylethyl]boronic acid?
The InChIKey is FUGYADAVGFHPGI-FJXQXJEOSA-N. The full InChI is InChI=1S/C8H11BO2.C4H11NO2/c1-7(9(10)11)8-5-3-2-4-6-8;6-3-1-5-2-4-7/h2-7,10-11H,1H3;5-7H,1-4H2/t7-;/m0./s1.
What are the key properties of 2-(2-hydroxyethylamino)ethanol;[(1S)-1-phenylethyl]boronic acid?
2-(2-hydroxyethylamino)ethanol;[(1S)-1-phenylethyl]boronic acid has a molecular weight of 255.12 g/mol, XLogP of -0.64, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethylamino)ethanol;[(1S)-1-phenylethyl]boronic acid is sourced from PubChem (CID 121012623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).